C39H40F3N5O6 — CID 22905013
3-[1-benzyl-7-[5-(diaminomethylideneamino)pentyl]-2,5-dioxo-3-phenyl-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 22905013) has the molecular formula C39H40F3N5O6 and a molecular weight of 731.77 g/mol. Its IUPAC name is 3-[1-benzyl-7-[5-(diaminomethylideneamino)pentyl]-2,5-dioxo-3-phenyl-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[1-benzyl-7-[5-(diaminomethylideneamino)pentyl]-2,5-dioxo-3-phenyl-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22905013 |
| Molecular Formula | C39H40F3N5O6 |
| Molecular Weight | 731.77 g/mol |
| Exact Mass | 731.29 |
| IUPAC Name | 3-[1-benzyl-7-[5-(diaminomethylideneamino)pentyl]-2,5-dioxo-3-phenyl-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | NC(N)=NCCCCCc1ccc2c(c1)C(=O)N(C(CC(=O)O)c1ccccc1)C(c1ccccc1)C(=O)N2Cc1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C37H39N5O4.C2HF3O2/c38-37(39)40-22-12-4-7-13-26-20-21-31-30(23-26)35(45)42(32(24-33(43)44)28-16-8-2-9-17-28)34(29-18-10-3-11-19-29)36(46)41(31)25-27-14-5-1-6-15-27;3-2(4,5)1(6)7/h1-3,5-6,8-11,14-21,23,32,34H,4,7,12-13,22,24-25H2,(H,43,44)(H4,38,39,40);(H,6,7) |
| InChIKey | INDXIMDTGDMMQJ-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 179.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.77 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|