C27H32F3N5O6 — CID 22905015
3-[7-[5-(diaminomethylideneamino)pentyl]-1-methyl-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 22905015) has the molecular formula C27H32F3N5O6 and a molecular weight of 579.58 g/mol. Its IUPAC name is 3-[7-[5-(diaminomethylideneamino)pentyl]-1-methyl-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[7-[5-(diaminomethylideneamino)pentyl]-1-methyl-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22905015 |
| Molecular Formula | C27H32F3N5O6 |
| Molecular Weight | 579.58 g/mol |
| Exact Mass | 579.23 |
| IUPAC Name | 3-[7-[5-(diaminomethylideneamino)pentyl]-1-methyl-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CN1C(=O)CN(C(CC(=O)O)c2ccccc2)C(=O)c2cc(CCCCCN=C(N)N)ccc21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H31N5O4.C2HF3O2/c1-29-20-12-11-17(8-4-3-7-13-28-25(26)27)14-19(20)24(34)30(16-22(29)31)21(15-23(32)33)18-9-5-2-6-10-18;3-2(4,5)1(6)7/h2,5-6,9-12,14,21H,3-4,7-8,13,15-16H2,1H3,(H,32,33)(H4,26,27,28);(H,6,7) |
| InChIKey | FCMUVLTVWPQZOK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 179.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.58 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|