C24H25Cl2IO3S — CID 22935143
bis(4-propan-2-ylphenyl)iodanium;2,5-dichlorobenzenesulfonate (PubChem CID 22935143) has the molecular formula C24H25Cl2IO3S and a molecular weight of 591.34 g/mol. Its IUPAC name is bis(4-propan-2-ylphenyl)iodanium;2,5-dichlorobenzenesulfonate.
| Compound Name | bis(4-propan-2-ylphenyl)iodanium;2,5-dichlorobenzenesulfonate |
|---|---|
| PubChem CID | 22935143 |
| Molecular Formula | C24H25Cl2IO3S |
| Molecular Weight | 591.34 g/mol |
| Exact Mass | 589.99 |
| IUPAC Name | bis(4-propan-2-ylphenyl)iodanium;2,5-dichlorobenzenesulfonate |
| SMILES | CC(C)c1ccc([I+]c2ccc(C(C)C)cc2)cc1.O=S(=O)([O-])c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C18H22I.C6H4Cl2O3S/c1-13(2)15-5-9-17(10-6-15)19-18-11-7-16(8-12-18)14(3)4;7-4-1-2-5(8)6(3-4)12(9,10)11/h5-14H,1-4H3;1-3H,(H,9,10,11)/q+1;/p-1 |
| InChIKey | WZVFVTVLVHMSBZ-UHFFFAOYSA-M |
| XLogP | 3.96 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.34 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|