About 1-(methoxysulfinylamino)-2,4,5-trimethylbenzene
1-(methoxysulfinylamino)-2,4,5-trimethylbenzene (PubChem CID 22942643) has the molecular formula C10H15NO2S
and a molecular weight of 213.30 g/mol. Its IUPAC name is 1-(methoxysulfinylamino)-2,4,5-trimethylbenzene.
Molecular Properties
| Compound Name | 1-(methoxysulfinylamino)-2,4,5-trimethylbenzene |
| PubChem CID | 22942643 |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 1-(methoxysulfinylamino)-2,4,5-trimethylbenzene |
| SMILES | COS(=O)Nc1cc(C)c(C)cc1C |
| InChI | InChI=1S/C10H15NO2S/c1-7-5-9(3)10(6-8(7)2)11-14(12)13-4/h5-6,11H,1-4H3 |
| InChIKey | DXOGATAWFMFMIB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(methoxysulfinylamino)-2,4,5-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(methoxysulfinylamino)-2,4,5-trimethylbenzene?
The IUPAC name of 1-(methoxysulfinylamino)-2,4,5-trimethylbenzene (CID 22942643) is 1-(methoxysulfinylamino)-2,4,5-trimethylbenzene.
What is the SMILES notation for 1-(methoxysulfinylamino)-2,4,5-trimethylbenzene?
The canonical SMILES for 1-(methoxysulfinylamino)-2,4,5-trimethylbenzene is COS(=O)Nc1cc(C)c(C)cc1C.
What is the InChIKey of 1-(methoxysulfinylamino)-2,4,5-trimethylbenzene?
The InChIKey is DXOGATAWFMFMIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO2S/c1-7-5-9(3)10(6-8(7)2)11-14(12)13-4/h5-6,11H,1-4H3.
What are the key properties of 1-(methoxysulfinylamino)-2,4,5-trimethylbenzene?
1-(methoxysulfinylamino)-2,4,5-trimethylbenzene has a molecular weight of 213.30 g/mol, XLogP of 2.25, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(methoxysulfinylamino)-2,4,5-trimethylbenzene is sourced from PubChem (CID 22942643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).