C10H15NO2S — CID 22942643
1-(methoxysulfinylamino)-2,4,5-trimethylbenzene (PubChem CID 22942643) has the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. Its IUPAC name is 1-(methoxysulfinylamino)-2,4,5-trimethylbenzene.
| Compound Name | 1-(methoxysulfinylamino)-2,4,5-trimethylbenzene |
|---|---|
| PubChem CID | 22942643 |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 1-(methoxysulfinylamino)-2,4,5-trimethylbenzene |
| SMILES | COS(=O)Nc1cc(C)c(C)cc1C |
| InChI | InChI=1S/C10H15NO2S/c1-7-5-9(3)10(6-8(7)2)11-14(12)13-4/h5-6,11H,1-4H3 |
| InChIKey | DXOGATAWFMFMIB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |