C27H16F6N2O5 — CID 22956804
5-[1,1,1,3,3,3-hexafluoro-2-[2-(3-hydroxy-4-methylphenyl)-1,3-dioxoisoindol-5-yl]propan-2-yl]-2-methylisoindole-1,3-dione (PubChem CID 22956804) has the molecular formula C27H16F6N2O5 and a molecular weight of 562.42 g/mol. Its IUPAC name is 5-[1,1,1,3,3,3-hexafluoro-2-[2-(3-hydroxy-4-methylphenyl)-1,3-dioxoisoindol-5-yl]propan-2-yl]-2-methylisoindole-1,3-dione.
| Compound Name | 5-[1,1,1,3,3,3-hexafluoro-2-[2-(3-hydroxy-4-methylphenyl)-1,3-dioxoisoindol-5-yl]propan-2-yl]-2-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 22956804 |
| Molecular Formula | C27H16F6N2O5 |
| Molecular Weight | 562.42 g/mol |
| Exact Mass | 562.10 |
| IUPAC Name | 5-[1,1,1,3,3,3-hexafluoro-2-[2-(3-hydroxy-4-methylphenyl)-1,3-dioxoisoindol-5-yl]propan-2-yl]-2-methylisoindole-1,3-dione |
| SMILES | Cc1ccc(N2C(=O)c3ccc(C(c4ccc5c(c4)C(=O)N(C)C5=O)(C(F)(F)F)C(F)(F)F)cc3C2=O)cc1O |
| InChI | InChI=1S/C27H16F6N2O5/c1-12-3-6-15(11-20(12)36)35-23(39)17-8-5-14(10-19(17)24(35)40)25(26(28,29)30,27(31,32)33)13-4-7-16-18(9-13)22(38)34(2)21(16)37/h3-11,36H,1-2H3 |
| InChIKey | XYCXPULZKKTMBY-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.42 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|