C35H24F6N2O6 — CID 21350854
5-[2-[5-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2-hydroxyphenyl]-6-methyl-1,3-dioxoisoindol-5-yl]-2,6-dimethylisoindole-1,3-dione (PubChem CID 21350854) has the molecular formula C35H24F6N2O6 and a molecular weight of 682.57 g/mol. Its IUPAC name is 5-[2-[5-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2-hydroxyphenyl]-6-methyl-1,3-dioxoisoindol-5-yl]-2,6-dimethylisoindole-1,3-dione.
| Compound Name | 5-[2-[5-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2-hydroxyphenyl]-6-methyl-1,3-dioxoisoindol-5-yl]-2,6-dimethylisoindole-1,3-dione |
|---|---|
| PubChem CID | 21350854 |
| Molecular Formula | C35H24F6N2O6 |
| Molecular Weight | 682.57 g/mol |
| Exact Mass | 682.15 |
| IUPAC Name | 5-[2-[5-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2-hydroxyphenyl]-6-methyl-1,3-dioxoisoindol-5-yl]-2,6-dimethylisoindole-1,3-dione |
| SMILES | Cc1cc(C(c2ccc(O)c(N3C(=O)c4cc(C)c(-c5cc6c(cc5C)C(=O)N(C)C6=O)cc4C3=O)c2)(C(F)(F)F)C(F)(F)F)ccc1O |
| InChI | InChI=1S/C35H24F6N2O6/c1-15-10-22-24(30(47)42(4)29(22)46)13-20(15)21-14-25-23(11-16(21)2)31(48)43(32(25)49)26-12-19(6-8-28(26)45)33(34(36,37)38,35(39,40)41)18-5-7-27(44)17(3)9-18/h5-14,44-45H,1-4H3 |
| InChIKey | HHKABYXKMBPWGU-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.57 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|