C33H16F6N2O10 — CID 4319306
2-[5-[2-[3-(5-carboxy-1,3-dioxoisoindol-2-yl)-4-hydroxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 4319306) has the molecular formula C33H16F6N2O10 and a molecular weight of 714.48 g/mol. Its IUPAC name is 2-[5-[2-[3-(5-carboxy-1,3-dioxoisoindol-2-yl)-4-hydroxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-[5-[2-[3-(5-carboxy-1,3-dioxoisoindol-2-yl)-4-hydroxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 4319306 |
| Molecular Formula | C33H16F6N2O10 |
| Molecular Weight | 714.48 g/mol |
| Exact Mass | 714.07 |
| IUPAC Name | 2-[5-[2-[3-(5-carboxy-1,3-dioxoisoindol-2-yl)-4-hydroxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)N(c1cc(C(c3ccc(O)c(N4C(=O)c5ccc(C(=O)O)cc5C4=O)c3)(C(F)(F)F)C(F)(F)F)ccc1O)C2=O |
| InChI | InChI=1S/C33H16F6N2O10/c34-32(35,36)31(33(37,38)39,15-3-7-23(42)21(11-15)40-25(44)17-5-1-13(29(48)49)9-19(17)27(40)46)16-4-8-24(43)22(12-16)41-26(45)18-6-2-14(30(50)51)10-20(18)28(41)47/h1-12,42-43H,(H,48,49)(H,50,51) |
| InChIKey | ZVKWABPKKWMSCG-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 189.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.48 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|