C19H24Cl2N2Ti-2 — CID 22968000
dichlorotitanium;(2,4-dimethylphenyl)-[3-(2,4-dimethylphenyl)azanidylpropyl]azanide (PubChem CID 22968000) has the molecular formula C19H24Cl2N2Ti-2 and a molecular weight of 399.19 g/mol. Its IUPAC name is dichlorotitanium;(2,4-dimethylphenyl)-[3-(2,4-dimethylphenyl)azanidylpropyl]azanide.
| Compound Name | dichlorotitanium;(2,4-dimethylphenyl)-[3-(2,4-dimethylphenyl)azanidylpropyl]azanide |
|---|---|
| PubChem CID | 22968000 |
| Molecular Formula | C19H24Cl2N2Ti-2 |
| Molecular Weight | 399.19 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | dichlorotitanium;(2,4-dimethylphenyl)-[3-(2,4-dimethylphenyl)azanidylpropyl]azanide |
| SMILES | Cc1ccc([N-]CCC[N-]c2ccc(C)cc2C)c(C)c1.Cl[Ti]Cl |
| InChI | InChI=1S/C19H24N2.2ClH.Ti/c1-14-6-8-18(16(3)12-14)20-10-5-11-21-19-9-7-15(2)13-17(19)4;;;/h6-9,12-13H,5,10-11H2,1-4H3;2*1H;/q-2;;;+2/p-2 |
| InChIKey | OITLYXLXVUGXJZ-UHFFFAOYSA-L |
| XLogP | 7.40 |
| TPSA | 28.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.19 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|