C10H15Bi — CID 87791947
(2,4-dimethylphenyl)-dimethylbismuthane (PubChem CID 87791947) has the molecular formula C10H15Bi and a molecular weight of 344.21 g/mol. Its IUPAC name is (2,4-dimethylphenyl)-dimethylbismuthane.
| Compound Name | (2,4-dimethylphenyl)-dimethylbismuthane |
|---|---|
| PubChem CID | 87791947 |
| Molecular Formula | C10H15Bi |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | (2,4-dimethylphenyl)-dimethylbismuthane |
| SMILES | Cc1ccc([Bi](C)C)c(C)c1 |
| InChI | InChI=1S/C8H9.2CH3.Bi/c1-7-4-3-5-8(2)6-7;;;/h3-4,6H,1-2H3;2*1H3; |
| InChIKey | UZBOCMSGTMQYML-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |