C16H18I- — CID 6400107
1-(2,4-dimethylphenyl)iodanuidyl-2,4-dimethylbenzene (PubChem CID 6400107) has the molecular formula C16H18I- and a molecular weight of 337.22 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)iodanuidyl-2,4-dimethylbenzene.
| Compound Name | 1-(2,4-dimethylphenyl)iodanuidyl-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 6400107 |
| Molecular Formula | C16H18I- |
| Molecular Weight | 337.22 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 1-(2,4-dimethylphenyl)iodanuidyl-2,4-dimethylbenzene |
| SMILES | Cc1ccc([I-]c2ccc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C16H18I/c1-11-5-7-15(13(3)9-11)17-16-8-6-12(2)10-14(16)4/h5-10H,1-4H3/q-1 |
| InChIKey | WQNPDJCXBYTVEJ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.22 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|