C12H22N2O3 — CID 22973589
4,6-bis(prop-1-en-2-ylamino)cyclohexane-1,2,3-triol (PubChem CID 22973589) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is 4,6-bis(prop-1-en-2-ylamino)cyclohexane-1,2,3-triol.
| Compound Name | 4,6-bis(prop-1-en-2-ylamino)cyclohexane-1,2,3-triol |
|---|---|
| PubChem CID | 22973589 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 4,6-bis(prop-1-en-2-ylamino)cyclohexane-1,2,3-triol |
| SMILES | C=C(C)NC1CC(NC(=C)C)C(O)C(O)C1O |
| InChI | InChI=1S/C12H22N2O3/c1-6(2)13-8-5-9(14-7(3)4)11(16)12(17)10(8)15/h8-17H,1,3,5H2,2,4H3 |
| InChIKey | HKFXYVVXTFONGF-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |