C23H18N4O4 — CID 22978134
3-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-N-methyl-N-(3-nitrophenyl)-1H-indazol-6-amine (PubChem CID 22978134) has the molecular formula C23H18N4O4 and a molecular weight of 414.42 g/mol. Its IUPAC name is 3-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-N-methyl-N-(3-nitrophenyl)-1H-indazol-6-amine.
| Compound Name | 3-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-N-methyl-N-(3-nitrophenyl)-1H-indazol-6-amine |
|---|---|
| PubChem CID | 22978134 |
| Molecular Formula | C23H18N4O4 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 3-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-N-methyl-N-(3-nitrophenyl)-1H-indazol-6-amine |
| SMILES | CN(c1cccc([N+](=O)[O-])c1)c1ccc2c(/C=C/c3ccc4c(c3)OCO4)n[nH]c2c1 |
| InChI | InChI=1S/C23H18N4O4/c1-26(16-3-2-4-18(12-16)27(28)29)17-7-8-19-20(24-25-21(19)13-17)9-5-15-6-10-22-23(11-15)31-14-30-22/h2-13H,14H2,1H3,(H,24,25)/b9-5+ |
| InChIKey | DOESMITXBLSKBH-WEVVVXLNSA-N |
| XLogP | 5.14 |
| TPSA | 93.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|