C12H10N4O3S — CID 3597387
4-amino-6-[2-(1,3-benzodioxol-5-yl)ethenyl]-3-sulfanylidene-2H-1,2,4-triazin-5-one (PubChem CID 3597387) has the molecular formula C12H10N4O3S and a molecular weight of 290.30 g/mol. Its IUPAC name is 4-amino-6-[2-(1,3-benzodioxol-5-yl)ethenyl]-3-sulfanylidene-2H-1,2,4-triazin-5-one.
| Compound Name | 4-amino-6-[2-(1,3-benzodioxol-5-yl)ethenyl]-3-sulfanylidene-2H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 3597387 |
| Molecular Formula | C12H10N4O3S |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 4-amino-6-[2-(1,3-benzodioxol-5-yl)ethenyl]-3-sulfanylidene-2H-1,2,4-triazin-5-one |
| SMILES | Nn1c(=S)[nH]nc(C=Cc2ccc3c(c2)OCO3)c1=O |
| InChI | InChI=1S/C12H10N4O3S/c13-16-11(17)8(14-15-12(16)20)3-1-7-2-4-9-10(5-7)19-6-18-9/h1-5H,6,13H2,(H,15,20) |
| InChIKey | QXXROSYEGYCRLH-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|