C50H36F6N2O4 — CID 22978860
5-[2-[2-[2,6-dimethyl-4-[9-(3,4,5-trimethylphenyl)fluoren-9-yl]phenyl]-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylisoindole-1,3-dione (PubChem CID 22978860) has the molecular formula C50H36F6N2O4 and a molecular weight of 842.84 g/mol. Its IUPAC name is 5-[2-[2-[2,6-dimethyl-4-[9-(3,4,5-trimethylphenyl)fluoren-9-yl]phenyl]-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylisoindole-1,3-dione.
| Compound Name | 5-[2-[2-[2,6-dimethyl-4-[9-(3,4,5-trimethylphenyl)fluoren-9-yl]phenyl]-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 22978860 |
| Molecular Formula | C50H36F6N2O4 |
| Molecular Weight | 842.84 g/mol |
| Exact Mass | 842.26 |
| IUPAC Name | 5-[2-[2-[2,6-dimethyl-4-[9-(3,4,5-trimethylphenyl)fluoren-9-yl]phenyl]-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylisoindole-1,3-dione |
| SMILES | Cc1cc(C2(c3cc(C)c(N4C(=O)c5ccc(C(c6ccc7c(c6)C(=O)N(C)C7=O)(C(F)(F)F)C(F)(F)F)cc5C4=O)c(C)c3)c3ccccc3-c3ccccc32)cc(C)c1C |
| InChI | InChI=1S/C50H36F6N2O4/c1-25-19-32(20-26(2)29(25)5)47(40-13-9-7-11-34(40)35-12-8-10-14-41(35)47)33-21-27(3)42(28(4)22-33)58-45(61)37-18-16-31(24-39(37)46(58)62)48(49(51,52)53,50(54,55)56)30-15-17-36-38(23-30)44(60)57(6)43(36)59/h7-24H,1-6H3 |
| InChIKey | JDVNDSPLMXOFHX-UHFFFAOYSA-N |
| XLogP | 11.03 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.84 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|