C4H5NO6 — CID 22994594
(3-carboxyoxyaziridin-2-yl) hydrogen carbonate (PubChem CID 22994594) has the molecular formula C4H5NO6 and a molecular weight of 163.08 g/mol. Its IUPAC name is (3-carboxyoxyaziridin-2-yl) hydrogen carbonate.
| Compound Name | (3-carboxyoxyaziridin-2-yl) hydrogen carbonate |
|---|---|
| PubChem CID | 22994594 |
| Molecular Formula | C4H5NO6 |
| Molecular Weight | 163.08 g/mol |
| Exact Mass | 163.01 |
| IUPAC Name | (3-carboxyoxyaziridin-2-yl) hydrogen carbonate |
| SMILES | O=C(O)OC1NC1OC(=O)O |
| InChI | InChI=1S/C4H5NO6/c6-3(7)10-1-2(5-1)11-4(8)9/h1-2,5H,(H,6,7)(H,8,9) |
| InChIKey | MJYHNYVKVALDDW-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 115.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.08 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|