C4H4O7 — CID 88598950
[(2S,3R)-3-carboxyoxyoxiran-2-yl] hydrogen carbonate (PubChem CID 88598950) has the molecular formula C4H4O7 and a molecular weight of 164.07 g/mol. Its IUPAC name is [(2S,3R)-3-carboxyoxyoxiran-2-yl] hydrogen carbonate.
| Compound Name | [(2S,3R)-3-carboxyoxyoxiran-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 88598950 |
| Molecular Formula | C4H4O7 |
| Molecular Weight | 164.07 g/mol |
| Exact Mass | 164.00 |
| IUPAC Name | [(2S,3R)-3-carboxyoxyoxiran-2-yl] hydrogen carbonate |
| SMILES | O=C(O)O[C@@H]1O[C@@H]1OC(=O)O |
| InChI | InChI=1S/C4H4O7/c5-3(6)10-1-2(9-1)11-4(7)8/h1-2H,(H,5,6)(H,7,8)/t1-,2+ |
| InChIKey | XWNGWEUQNAVKBW-XIXRPRMCSA-N |
| XLogP | 0.06 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.07 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|