C6H6O6 — CID 67756815
[(1S,2S)-2-carboxyoxy-3-methylidenecyclopropyl] hydrogen carbonate (PubChem CID 67756815) has the molecular formula C6H6O6 and a molecular weight of 174.11 g/mol. Its IUPAC name is [(1S,2S)-2-carboxyoxy-3-methylidenecyclopropyl] hydrogen carbonate.
| Compound Name | [(1S,2S)-2-carboxyoxy-3-methylidenecyclopropyl] hydrogen carbonate |
|---|---|
| PubChem CID | 67756815 |
| Molecular Formula | C6H6O6 |
| Molecular Weight | 174.11 g/mol |
| Exact Mass | 174.02 |
| IUPAC Name | [(1S,2S)-2-carboxyoxy-3-methylidenecyclopropyl] hydrogen carbonate |
| SMILES | C=C1[C@H](OC(=O)O)[C@H]1OC(=O)O |
| InChI | InChI=1S/C6H6O6/c1-2-3(11-5(7)8)4(2)12-6(9)10/h3-4H,1H2,(H,7,8)(H,9,10)/t3-,4-/m0/s1 |
| InChIKey | KFNVLXODQKYQQU-IMJSIDKUSA-N |
| XLogP | 0.68 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.11 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|