[(1S,2S)-2-carboxyoxy-3-methylidenecyclopropyl] hydrogen carbonate

C6H6O6 — CID 67756815

IUPAC[(1S,2S)-2-carboxyoxy-3-methylidenecyclopropyl] hydrogen carbonate
SMILESC=C1[C@H](OC(=O)O)[C@H]1OC(=O)O
InChIInChI=1S/C6H6O6/c1-2-3(11-5(7)8)4(2)12-6(9)10/h3-4H,1H2,(H,7,8)(H,9,10)/t3-,4-/m0/s1
InChIKeyKFNVLXODQKYQQU-IMJSIDKUSA-N
MW174.11 g/mol
LogP0.68
Rot. Bonds2

About [(1S,2S)-2-carboxyoxy-3-methylidenecyclopropyl] hydrogen carbonate

[(1S,2S)-2-carboxyoxy-3-methylidenecyclopropyl] hydrogen carbonate (PubChem CID 67756815) has the molecular formula C6H6O6 and a molecular weight of 174.11 g/mol. Its IUPAC name is [(1S,2S)-2-carboxyoxy-3-methylidenecyclopropyl] hydrogen carbonate.

Molecular Properties

Compound Name[(1S,2S)-2-carboxyoxy-3-methylidenecyclopropyl] hydrogen carbonate
PubChem CID67756815
Molecular FormulaC6H6O6
Molecular Weight174.11 g/mol
Exact Mass174.02
IUPAC Name[(1S,2S)-2-carboxyoxy-3-methylidenecyclopropyl] hydrogen carbonate
SMILESC=C1[C@H](OC(=O)O)[C@H]1OC(=O)O
InChIInChI=1S/C6H6O6/c1-2-3(11-5(7)8)4(2)12-6(9)10/h3-4H,1H2,(H,7,8)(H,9,10)/t3-,4-/m0/s1
InChIKeyKFNVLXODQKYQQU-IMJSIDKUSA-N
XLogP0.68
TPSA93.06 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500174.11
LogP ≤ 50.68
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze [(1S,2S)-2-carboxyoxy-3-methylidenecyclopropyl] hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(1S,2S)-2-carboxyoxy-3-methylidenecyclopropyl] hydrogen carbonate?
The IUPAC name of [(1S,2S)-2-carboxyoxy-3-methylidenecyclopropyl] hydrogen carbonate (CID 67756815) is [(1S,2S)-2-carboxyoxy-3-methylidenecyclopropyl] hydrogen carbonate.
What is the SMILES notation for [(1S,2S)-2-carboxyoxy-3-methylidenecyclopropyl] hydrogen carbonate?
The canonical SMILES for [(1S,2S)-2-carboxyoxy-3-methylidenecyclopropyl] hydrogen carbonate is C=C1[C@H](OC(=O)O)[C@H]1OC(=O)O.
What is the InChIKey of [(1S,2S)-2-carboxyoxy-3-methylidenecyclopropyl] hydrogen carbonate?
The InChIKey is KFNVLXODQKYQQU-IMJSIDKUSA-N. The full InChI is InChI=1S/C6H6O6/c1-2-3(11-5(7)8)4(2)12-6(9)10/h3-4H,1H2,(H,7,8)(H,9,10)/t3-,4-/m0/s1.
What are the key properties of [(1S,2S)-2-carboxyoxy-3-methylidenecyclopropyl] hydrogen carbonate?
[(1S,2S)-2-carboxyoxy-3-methylidenecyclopropyl] hydrogen carbonate has a molecular weight of 174.11 g/mol, XLogP of 0.68, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2S)-2-carboxyoxy-3-methylidenecyclopropyl] hydrogen carbonate is sourced from PubChem (CID 67756815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).