C7H13N5O2 — CID 22995888
[5-(ethylamino)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]urea (PubChem CID 22995888) has the molecular formula C7H13N5O2 and a molecular weight of 199.21 g/mol. Its IUPAC name is [5-(ethylamino)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]urea.
| Compound Name | [5-(ethylamino)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]urea |
|---|---|
| PubChem CID | 22995888 |
| Molecular Formula | C7H13N5O2 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | [5-(ethylamino)-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]urea |
| SMILES | CCNC1CN=C(NC(N)=O)NC1=O |
| InChI | InChI=1S/C7H13N5O2/c1-2-9-4-3-10-7(11-5(4)13)12-6(8)14/h4,9H,2-3H2,1H3,(H4,8,10,11,12,13,14) |
| InChIKey | GFZWYJYFJLYYTE-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |