C22H27N5O9-4 — CID 23041974
3-(2-ethoxyethyl)-N-(1-prop-2-enylpiperidin-4-yl)imidazo[4,5-b]pyridin-2-amine;oxalate (PubChem CID 23041974) has the molecular formula C22H27N5O9-4 and a molecular weight of 505.48 g/mol. Its IUPAC name is 3-(2-ethoxyethyl)-N-(1-prop-2-enylpiperidin-4-yl)imidazo[4,5-b]pyridin-2-amine;oxalate.
| Compound Name | 3-(2-ethoxyethyl)-N-(1-prop-2-enylpiperidin-4-yl)imidazo[4,5-b]pyridin-2-amine;oxalate |
|---|---|
| PubChem CID | 23041974 |
| Molecular Formula | C22H27N5O9-4 |
| Molecular Weight | 505.48 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | 3-(2-ethoxyethyl)-N-(1-prop-2-enylpiperidin-4-yl)imidazo[4,5-b]pyridin-2-amine;oxalate |
| SMILES | C=CCN1CCC(Nc2nc3cccnc3n2CCOCC)CC1.O=C([O-])C(=O)[O-].O=C([O-])C(=O)[O-] |
| InChI | InChI=1S/C18H27N5O.2C2H2O4/c1-3-10-22-11-7-15(8-12-22)20-18-21-16-6-5-9-19-17(16)23(18)13-14-24-4-2;2*3-1(4)2(5)6/h3,5-6,9,15H,1,4,7-8,10-14H2,2H3,(H,20,21);2*(H,3,4)(H,5,6)/p-4 |
| InChIKey | NQYJENGTCDDVLV-UHFFFAOYSA-J |
| XLogP | -4.50 |
| TPSA | 215.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.48 |
| LogP ≤ 5 | -4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|