C22H25N3O2S2 — CID 23046354
[4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)acetyl]-2-thiocyanato-1H-pyrrol-3-yl] thiocyanate (PubChem CID 23046354) has the molecular formula C22H25N3O2S2 and a molecular weight of 427.60 g/mol. Its IUPAC name is [4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)acetyl]-2-thiocyanato-1H-pyrrol-3-yl] thiocyanate.
| Compound Name | [4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)acetyl]-2-thiocyanato-1H-pyrrol-3-yl] thiocyanate |
|---|---|
| PubChem CID | 23046354 |
| Molecular Formula | C22H25N3O2S2 |
| Molecular Weight | 427.60 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | [4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)acetyl]-2-thiocyanato-1H-pyrrol-3-yl] thiocyanate |
| SMILES | CC(C)(C)c1cc(CC(=O)c2c[nH]c(SC#N)c2SC#N)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C22H25N3O2S2/c1-21(2,3)15-7-13(8-16(18(15)27)22(4,5)6)9-17(26)14-10-25-20(29-12-24)19(14)28-11-23/h7-8,10,25,27H,9H2,1-6H3 |
| InChIKey | QDUNKWQWRLMKPO-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.60 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|