C15H18O5 — CID 23050461
1-(1,3-benzodioxol-5-yl)-4-(1-ethoxyethoxy)but-2-yn-1-ol (PubChem CID 23050461) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-4-(1-ethoxyethoxy)but-2-yn-1-ol.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-4-(1-ethoxyethoxy)but-2-yn-1-ol |
|---|---|
| PubChem CID | 23050461 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-4-(1-ethoxyethoxy)but-2-yn-1-ol |
| SMILES | CCOC(C)OCC#CC(O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H18O5/c1-3-17-11(2)18-8-4-5-13(16)12-6-7-14-15(9-12)20-10-19-14/h6-7,9,11,13,16H,3,8,10H2,1-2H3 |
| InChIKey | QAFRPZFAEMYFFL-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|