About 1-(1,3-benzodioxol-5-yl)-4-(1-ethoxyethoxy)but-2-yn-1-ol
1-(1,3-benzodioxol-5-yl)-4-(1-ethoxyethoxy)but-2-yn-1-ol (PubChem CID 23050461) has the molecular formula C15H18O5
and a molecular weight of 278.30 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-4-(1-ethoxyethoxy)but-2-yn-1-ol.
Molecular Properties
| Compound Name | 1-(1,3-benzodioxol-5-yl)-4-(1-ethoxyethoxy)but-2-yn-1-ol |
| PubChem CID | 23050461 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-4-(1-ethoxyethoxy)but-2-yn-1-ol |
| SMILES | CCOC(C)OCC#CC(O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H18O5/c1-3-17-11(2)18-8-4-5-13(16)12-6-7-14-15(9-12)20-10-19-14/h6-7,9,11,13,16H,3,8,10H2,1-2H3 |
| InChIKey | QAFRPZFAEMYFFL-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,3-benzodioxol-5-yl)-4-(1-ethoxyethoxy)but-2-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-benzodioxol-5-yl)-4-(1-ethoxyethoxy)but-2-yn-1-ol?
The IUPAC name of 1-(1,3-benzodioxol-5-yl)-4-(1-ethoxyethoxy)but-2-yn-1-ol (CID 23050461) is 1-(1,3-benzodioxol-5-yl)-4-(1-ethoxyethoxy)but-2-yn-1-ol.
What is the SMILES notation for 1-(1,3-benzodioxol-5-yl)-4-(1-ethoxyethoxy)but-2-yn-1-ol?
The canonical SMILES for 1-(1,3-benzodioxol-5-yl)-4-(1-ethoxyethoxy)but-2-yn-1-ol is CCOC(C)OCC#CC(O)c1ccc2c(c1)OCO2.
What is the InChIKey of 1-(1,3-benzodioxol-5-yl)-4-(1-ethoxyethoxy)but-2-yn-1-ol?
The InChIKey is QAFRPZFAEMYFFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O5/c1-3-17-11(2)18-8-4-5-13(16)12-6-7-14-15(9-12)20-10-19-14/h6-7,9,11,13,16H,3,8,10H2,1-2H3.
What are the key properties of 1-(1,3-benzodioxol-5-yl)-4-(1-ethoxyethoxy)but-2-yn-1-ol?
1-(1,3-benzodioxol-5-yl)-4-(1-ethoxyethoxy)but-2-yn-1-ol has a molecular weight of 278.30 g/mol, XLogP of 1.85, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-benzodioxol-5-yl)-4-(1-ethoxyethoxy)but-2-yn-1-ol is sourced from PubChem (CID 23050461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).