C35H40O12S — CID 23062098
2-[4,5-diacetyloxy-2-[(4-methylphenyl)sulfonyloxymethyl]-3-phenylmethoxy-2-(phenylmethoxymethyl)oxolan-3-yl]ethyl acetate (PubChem CID 23062098) has the molecular formula C35H40O12S and a molecular weight of 684.76 g/mol. Its IUPAC name is 2-[4,5-diacetyloxy-2-[(4-methylphenyl)sulfonyloxymethyl]-3-phenylmethoxy-2-(phenylmethoxymethyl)oxolan-3-yl]ethyl acetate.
| Compound Name | 2-[4,5-diacetyloxy-2-[(4-methylphenyl)sulfonyloxymethyl]-3-phenylmethoxy-2-(phenylmethoxymethyl)oxolan-3-yl]ethyl acetate |
|---|---|
| PubChem CID | 23062098 |
| Molecular Formula | C35H40O12S |
| Molecular Weight | 684.76 g/mol |
| Exact Mass | 684.22 |
| IUPAC Name | 2-[4,5-diacetyloxy-2-[(4-methylphenyl)sulfonyloxymethyl]-3-phenylmethoxy-2-(phenylmethoxymethyl)oxolan-3-yl]ethyl acetate |
| SMILES | CC(=O)OCCC1(OCc2ccccc2)C(OC(C)=O)C(OC(C)=O)OC1(COCc1ccccc1)COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C35H40O12S/c1-25-15-17-31(18-16-25)48(39,40)44-24-34(23-41-21-29-11-7-5-8-12-29)35(19-20-42-26(2)36,43-22-30-13-9-6-10-14-30)32(45-27(3)37)33(47-34)46-28(4)38/h5-18,32-33H,19-24H2,1-4H3 |
| InChIKey | ZELCAFMTOBSHMZ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.76 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|