C43H48O11 — CID 11018076
[(1R,3S,4S,5S,6S,7S)-7-acetyloxy-1-(methoxymethyl)-4,6-bis(phenylmethoxy)-4,5-bis(phenylmethoxymethyl)-2,8-dioxabicyclo[3.2.1]octan-3-yl]methyl acetate (PubChem CID 11018076) has the molecular formula C43H48O11 and a molecular weight of 740.85 g/mol. Its IUPAC name is [(1R,3S,4S,5S,6S,7S)-7-acetyloxy-1-(methoxymethyl)-4,6-bis(phenylmethoxy)-4,5-bis(phenylmethoxymethyl)-2,8-dioxabicyclo[3.2.1]octan-3-yl]methyl acetate.
| Compound Name | [(1R,3S,4S,5S,6S,7S)-7-acetyloxy-1-(methoxymethyl)-4,6-bis(phenylmethoxy)-4,5-bis(phenylmethoxymethyl)-2,8-dioxabicyclo[3.2.1]octan-3-yl]methyl acetate |
|---|---|
| PubChem CID | 11018076 |
| Molecular Formula | C43H48O11 |
| Molecular Weight | 740.85 g/mol |
| Exact Mass | 740.32 |
| IUPAC Name | [(1R,3S,4S,5S,6S,7S)-7-acetyloxy-1-(methoxymethyl)-4,6-bis(phenylmethoxy)-4,5-bis(phenylmethoxymethyl)-2,8-dioxabicyclo[3.2.1]octan-3-yl]methyl acetate |
| SMILES | COC[C@@]12O[C@@H](COC(C)=O)[C@](COCc3ccccc3)(OCc3ccccc3)[C@@](COCc3ccccc3)(O1)[C@@H](OCc1ccccc1)[C@@H]2OC(C)=O |
| InChI | InChI=1S/C43H48O11/c1-32(44)49-28-38-41(51-27-37-22-14-7-15-23-37,29-47-24-34-16-8-4-9-17-34)42(30-48-25-35-18-10-5-11-19-35)39(50-26-36-20-12-6-13-21-36)40(52-33(2)45)43(53-38,54-42)31-46-3/h4-23,38-40H,24-31H2,1-3H3/t38-,39-,40-,41-,42-,43+/m0/s1 |
| InChIKey | LIMNJRYDVMOOCJ-YATXZJLRSA-N |
| XLogP | 5.97 |
| TPSA | 117.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.85 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |