C26H30O12 — CID 11734187
[(1R,3R,4S,5S,6R,7R)-7-acetyloxy-1,5-bis(acetyloxymethyl)-3-ethynyl-4-hydroxy-6-phenylmethoxy-2,8-dioxabicyclo[3.2.1]octan-4-yl]methyl acetate (PubChem CID 11734187) has the molecular formula C26H30O12 and a molecular weight of 534.51 g/mol. Its IUPAC name is [(1R,3R,4S,5S,6R,7R)-7-acetyloxy-1,5-bis(acetyloxymethyl)-3-ethynyl-4-hydroxy-6-phenylmethoxy-2,8-dioxabicyclo[3.2.1]octan-4-yl]methyl acetate.
| Compound Name | [(1R,3R,4S,5S,6R,7R)-7-acetyloxy-1,5-bis(acetyloxymethyl)-3-ethynyl-4-hydroxy-6-phenylmethoxy-2,8-dioxabicyclo[3.2.1]octan-4-yl]methyl acetate |
|---|---|
| PubChem CID | 11734187 |
| Molecular Formula | C26H30O12 |
| Molecular Weight | 534.51 g/mol |
| Exact Mass | 534.17 |
| IUPAC Name | [(1R,3R,4S,5S,6R,7R)-7-acetyloxy-1,5-bis(acetyloxymethyl)-3-ethynyl-4-hydroxy-6-phenylmethoxy-2,8-dioxabicyclo[3.2.1]octan-4-yl]methyl acetate |
| SMILES | C#C[C@H]1O[C@]2(COC(C)=O)O[C@@](COC(C)=O)([C@H](OCc3ccccc3)[C@H]2OC(C)=O)[C@]1(O)COC(C)=O |
| InChI | InChI=1S/C26H30O12/c1-6-21-24(31,13-33-16(2)27)25(14-34-17(3)28)22(32-12-20-10-8-7-9-11-20)23(36-19(5)30)26(37-21,38-25)15-35-18(4)29/h1,7-11,21-23,31H,12-15H2,2-5H3/t21-,22-,23-,24+,25+,26-/m1/s1 |
| InChIKey | GNVRETDTHWAUGJ-GNPXQVHSSA-N |
| XLogP | 0.42 |
| TPSA | 153.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.51 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|