C23H28O12 — CID 20744739
benzyl 2-[(3R,4S,5S,6R)-3,4-diacetyl-5-acetyloxy-6-(acetyloxymethyl)-3,4-dihydroxyoxan-2-yl]oxyacetate (PubChem CID 20744739) has the molecular formula C23H28O12 and a molecular weight of 496.47 g/mol. Its IUPAC name is benzyl 2-[(3R,4S,5S,6R)-3,4-diacetyl-5-acetyloxy-6-(acetyloxymethyl)-3,4-dihydroxyoxan-2-yl]oxyacetate.
| Compound Name | benzyl 2-[(3R,4S,5S,6R)-3,4-diacetyl-5-acetyloxy-6-(acetyloxymethyl)-3,4-dihydroxyoxan-2-yl]oxyacetate |
|---|---|
| PubChem CID | 20744739 |
| Molecular Formula | C23H28O12 |
| Molecular Weight | 496.47 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | benzyl 2-[(3R,4S,5S,6R)-3,4-diacetyl-5-acetyloxy-6-(acetyloxymethyl)-3,4-dihydroxyoxan-2-yl]oxyacetate |
| SMILES | CC(=O)OC[C@H]1OC(OCC(=O)OCc2ccccc2)[C@@](O)(C(C)=O)[C@](O)(C(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C23H28O12/c1-13(24)22(29)20(34-16(4)27)18(11-31-15(3)26)35-21(23(22,30)14(2)25)33-12-19(28)32-10-17-8-6-5-7-9-17/h5-9,18,20-21,29-30H,10-12H2,1-4H3/t18-,20+,21?,22+,23+/m1/s1 |
| InChIKey | HBNFXMGCKVSPHQ-DXNDDPRCSA-N |
| XLogP | -0.39 |
| TPSA | 171.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.47 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|