C62H64O11 — CID 173173026
[(2R,3R,4S,5R,6R)-6-phenyl-3,4,5-tris(phenylmethoxy)-6-[[(2R,3R,4R,5S)-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]oxan-2-yl]methyl acetate (PubChem CID 173173026) has the molecular formula C62H64O11 and a molecular weight of 985.18 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-6-phenyl-3,4,5-tris(phenylmethoxy)-6-[[(2R,3R,4R,5S)-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-6-phenyl-3,4,5-tris(phenylmethoxy)-6-[[(2R,3R,4R,5S)-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 173173026 |
| Molecular Formula | C62H64O11 |
| Molecular Weight | 985.18 g/mol |
| Exact Mass | 984.44 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-6-phenyl-3,4,5-tris(phenylmethoxy)-6-[[(2R,3R,4R,5S)-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@](OC[C@H]2OC[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)(c2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C62H64O11/c1-46(63)64-44-56-59(69-40-50-29-15-5-16-30-50)60(70-41-51-31-17-6-18-32-51)61(71-42-52-33-19-7-20-34-52)62(73-56,53-35-21-8-22-36-53)72-45-55-58(68-39-49-27-13-4-14-28-49)57(67-38-48-25-11-3-12-26-48)54(43-66-55)65-37-47-23-9-2-10-24-47/h2-36,54-61H,37-45H2,1H3/t54-,55+,56+,57+,58+,59+,60-,61+,62+/m0/s1 |
| InChIKey | HSYNTCFELLRZGA-OHAKTDFESA-N |
| XLogP | 10.73 |
| TPSA | 109.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 73 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 985.18 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |