About 2-thia-3,7-diazaspiro[4.4]nonane
2-thia-3,7-diazaspiro[4.4]nonane (PubChem CID 23135390) has the molecular formula C6H12N2S
and a molecular weight of 144.24 g/mol. Its IUPAC name is 2-thia-3,7-diazaspiro[4.4]nonane.
Molecular Properties
| Compound Name | 2-thia-3,7-diazaspiro[4.4]nonane |
| PubChem CID | 23135390 |
| Molecular Formula | C6H12N2S |
| Molecular Weight | 144.24 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | 2-thia-3,7-diazaspiro[4.4]nonane |
| SMILES | C1CC2(CN1)CNSC2 |
| InChI | InChI=1S/C6H12N2S/c1-2-7-3-6(1)4-8-9-5-6/h7-8H,1-5H2 |
| InChIKey | NOUYKJIQZTWEBG-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.24 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-thia-3,7-diazaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thia-3,7-diazaspiro[4.4]nonane?
The IUPAC name of 2-thia-3,7-diazaspiro[4.4]nonane (CID 23135390) is 2-thia-3,7-diazaspiro[4.4]nonane.
What is the SMILES notation for 2-thia-3,7-diazaspiro[4.4]nonane?
The canonical SMILES for 2-thia-3,7-diazaspiro[4.4]nonane is C1CC2(CN1)CNSC2.
What is the InChIKey of 2-thia-3,7-diazaspiro[4.4]nonane?
The InChIKey is NOUYKJIQZTWEBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2S/c1-2-7-3-6(1)4-8-9-5-6/h7-8H,1-5H2.
What are the key properties of 2-thia-3,7-diazaspiro[4.4]nonane?
2-thia-3,7-diazaspiro[4.4]nonane has a molecular weight of 144.24 g/mol, XLogP of 0.22, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thia-3,7-diazaspiro[4.4]nonane is sourced from PubChem (CID 23135390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).