C14H24N2+2 — CID 2314670
1-[3-(aziridin-1-ium-1-yl)-5,5-dimethylcyclohex-2-en-1-ylidene]pyrrolidin-1-ium (PubChem CID 2314670) has the molecular formula C14H24N2+2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 1-[3-(aziridin-1-ium-1-yl)-5,5-dimethylcyclohex-2-en-1-ylidene]pyrrolidin-1-ium.
| Compound Name | 1-[3-(aziridin-1-ium-1-yl)-5,5-dimethylcyclohex-2-en-1-ylidene]pyrrolidin-1-ium |
|---|---|
| PubChem CID | 2314670 |
| Molecular Formula | C14H24N2+2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 1-[3-(aziridin-1-ium-1-yl)-5,5-dimethylcyclohex-2-en-1-ylidene]pyrrolidin-1-ium |
| SMILES | CC1(C)CC([NH+]2CC2)=CC(=[N+]2CCCC2)C1 |
| InChI | InChI=1S/C14H23N2/c1-14(2)10-12(15-5-3-4-6-15)9-13(11-14)16-7-8-16/h9H,3-8,10-11H2,1-2H3/q+1/p+1 |
| InChIKey | LJZQTQCAJSTRKT-UHFFFAOYSA-O |
| XLogP | 0.84 |
| TPSA | 7.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|