C24H20BrN5S — CID 2315196
(2Z)-2-[4-(4-bromophenyl)-3-phenyl-1,3-thiazol-2-ylidene]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)acetonitrile (PubChem CID 2315196) has the molecular formula C24H20BrN5S and a molecular weight of 490.43 g/mol. Its IUPAC name is (2Z)-2-[4-(4-bromophenyl)-3-phenyl-1,3-thiazol-2-ylidene]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)acetonitrile.
| Compound Name | (2Z)-2-[4-(4-bromophenyl)-3-phenyl-1,3-thiazol-2-ylidene]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)acetonitrile |
|---|---|
| PubChem CID | 2315196 |
| Molecular Formula | C24H20BrN5S |
| Molecular Weight | 490.43 g/mol |
| Exact Mass | 489.06 |
| IUPAC Name | (2Z)-2-[4-(4-bromophenyl)-3-phenyl-1,3-thiazol-2-ylidene]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)acetonitrile |
| SMILES | N#C/C(=C1/SC=C(c2ccc(Br)cc2)N1c1ccccc1)c1nnc2n1CCCCC2 |
| InChI | InChI=1S/C24H20BrN5S/c25-18-12-10-17(11-13-18)21-16-31-24(30(21)19-7-3-1-4-8-19)20(15-26)23-28-27-22-9-5-2-6-14-29(22)23/h1,3-4,7-8,10-13,16H,2,5-6,9,14H2/b24-20- |
| InChIKey | LCOXYUUOZAIZFQ-GFMRDNFCSA-N |
| XLogP | 6.21 |
| TPSA | 57.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.43 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|