C26H25N5OS — CID 2315210
(2Z)-2-[4-(4-ethoxyphenyl)-3-phenyl-1,3-thiazol-2-ylidene]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)acetonitrile (PubChem CID 2315210) has the molecular formula C26H25N5OS and a molecular weight of 455.59 g/mol. Its IUPAC name is (2Z)-2-[4-(4-ethoxyphenyl)-3-phenyl-1,3-thiazol-2-ylidene]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)acetonitrile.
| Compound Name | (2Z)-2-[4-(4-ethoxyphenyl)-3-phenyl-1,3-thiazol-2-ylidene]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)acetonitrile |
|---|---|
| PubChem CID | 2315210 |
| Molecular Formula | C26H25N5OS |
| Molecular Weight | 455.59 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | (2Z)-2-[4-(4-ethoxyphenyl)-3-phenyl-1,3-thiazol-2-ylidene]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)acetonitrile |
| SMILES | CCOc1ccc(C2=CS/C(=C(/C#N)c3nnc4n3CCCCC4)N2c2ccccc2)cc1 |
| InChI | InChI=1S/C26H25N5OS/c1-2-32-21-14-12-19(13-15-21)23-18-33-26(31(23)20-9-5-3-6-10-20)22(17-27)25-29-28-24-11-7-4-8-16-30(24)25/h3,5-6,9-10,12-15,18H,2,4,7-8,11,16H2,1H3/b26-22- |
| InChIKey | JYFNEQKBYQQQRL-ROMGYVFFSA-N |
| XLogP | 5.85 |
| TPSA | 66.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.59 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|