C20H20FN5S — CID 2316909
(2E)-2-[3-ethyl-4-(4-fluorophenyl)-1,3-thiazol-2-ylidene]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)acetonitrile (PubChem CID 2316909) has the molecular formula C20H20FN5S and a molecular weight of 381.48 g/mol. Its IUPAC name is (2E)-2-[3-ethyl-4-(4-fluorophenyl)-1,3-thiazol-2-ylidene]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)acetonitrile.
| Compound Name | (2E)-2-[3-ethyl-4-(4-fluorophenyl)-1,3-thiazol-2-ylidene]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)acetonitrile |
|---|---|
| PubChem CID | 2316909 |
| Molecular Formula | C20H20FN5S |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | (2E)-2-[3-ethyl-4-(4-fluorophenyl)-1,3-thiazol-2-ylidene]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)acetonitrile |
| SMILES | CCN1C(c2ccc(F)cc2)=CS/C1=C(\C#N)c1nnc2n1CCCCC2 |
| InChI | InChI=1S/C20H20FN5S/c1-2-25-17(14-7-9-15(21)10-8-14)13-27-20(25)16(12-22)19-24-23-18-6-4-3-5-11-26(18)19/h7-10,13H,2-6,11H2,1H3/b20-16+ |
| InChIKey | JFVUDXKWJOEWNA-CAPFRKAQSA-N |
| XLogP | 4.40 |
| TPSA | 57.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|