C21H23N5OS — CID 7740641
(2Z)-2-[3-ethyl-4-(4-methoxyphenyl)-1,3-thiazol-2-ylidene]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)acetonitrile (PubChem CID 7740641) has the molecular formula C21H23N5OS and a molecular weight of 393.52 g/mol. Its IUPAC name is (2Z)-2-[3-ethyl-4-(4-methoxyphenyl)-1,3-thiazol-2-ylidene]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)acetonitrile.
| Compound Name | (2Z)-2-[3-ethyl-4-(4-methoxyphenyl)-1,3-thiazol-2-ylidene]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)acetonitrile |
|---|---|
| PubChem CID | 7740641 |
| Molecular Formula | C21H23N5OS |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | (2Z)-2-[3-ethyl-4-(4-methoxyphenyl)-1,3-thiazol-2-ylidene]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)acetonitrile |
| SMILES | CCN1C(c2ccc(OC)cc2)=CS/C1=C(/C#N)c1nnc2n1CCCCC2 |
| InChI | InChI=1S/C21H23N5OS/c1-3-25-18(15-8-10-16(27-2)11-9-15)14-28-21(25)17(13-22)20-24-23-19-7-5-4-6-12-26(19)20/h8-11,14H,3-7,12H2,1-2H3/b21-17- |
| InChIKey | FLJFXNGJSXFXGU-FXBPSFAMSA-N |
| XLogP | 4.27 |
| TPSA | 66.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|