C19H24ClN5O3 — CID 23153150
1-[4-(4-amino-3-chlorophenoxy)-2-pyridinyl]-3-(3-morpholin-4-ylpropyl)urea (PubChem CID 23153150) has the molecular formula C19H24ClN5O3 and a molecular weight of 405.89 g/mol. Its IUPAC name is 1-[4-(4-amino-3-chlorophenoxy)-2-pyridinyl]-3-(3-morpholin-4-ylpropyl)urea.
| Compound Name | 1-[4-(4-amino-3-chlorophenoxy)-2-pyridinyl]-3-(3-morpholin-4-ylpropyl)urea |
|---|---|
| PubChem CID | 23153150 |
| Molecular Formula | C19H24ClN5O3 |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 1-[4-(4-amino-3-chlorophenoxy)-2-pyridinyl]-3-(3-morpholin-4-ylpropyl)urea |
| SMILES | Nc1ccc(Oc2ccnc(NC(=O)NCCCN3CCOCC3)c2)cc1Cl |
| InChI | InChI=1S/C19H24ClN5O3/c20-16-12-14(2-3-17(16)21)28-15-4-6-22-18(13-15)24-19(26)23-5-1-7-25-8-10-27-11-9-25/h2-4,6,12-13H,1,5,7-11,21H2,(H2,22,23,24,26) |
| InChIKey | LFUCHOBZDZVCSC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|