C19H23Cl2NO6P2 — CID 2317816
[(1S)-2,2-dichloro-2-diethoxyphosphoryl-1-diphenylphosphorylethyl] carbamate (PubChem CID 2317816) has the molecular formula C19H23Cl2NO6P2 and a molecular weight of 494.25 g/mol. Its IUPAC name is [(1S)-2,2-dichloro-2-diethoxyphosphoryl-1-diphenylphosphorylethyl] carbamate.
| Compound Name | [(1S)-2,2-dichloro-2-diethoxyphosphoryl-1-diphenylphosphorylethyl] carbamate |
|---|---|
| PubChem CID | 2317816 |
| Molecular Formula | C19H23Cl2NO6P2 |
| Molecular Weight | 494.25 g/mol |
| Exact Mass | 493.04 |
| IUPAC Name | [(1S)-2,2-dichloro-2-diethoxyphosphoryl-1-diphenylphosphorylethyl] carbamate |
| SMILES | CCOP(=O)(OCC)C(Cl)(Cl)[C@@H](OC(N)=O)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H23Cl2NO6P2/c1-3-26-30(25,27-4-2)19(20,21)17(28-18(22)23)29(24,15-11-7-5-8-12-15)16-13-9-6-10-14-16/h5-14,17H,3-4H2,1-2H3,(H2,22,23)/t17-/m0/s1 |
| InChIKey | PPFFTVHZPSFMOH-KRWDZBQOSA-N |
| XLogP | 4.82 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.25 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|