C22H18N4O3S2 — CID 2318874
2-(furan-2-ylmethylidene)-N,N'-bis(phenylcarbamothioyl)propanediamide (PubChem CID 2318874) has the molecular formula C22H18N4O3S2 and a molecular weight of 450.55 g/mol. Its IUPAC name is 2-(furan-2-ylmethylidene)-N,N'-bis(phenylcarbamothioyl)propanediamide.
| Compound Name | 2-(furan-2-ylmethylidene)-N,N'-bis(phenylcarbamothioyl)propanediamide |
|---|---|
| PubChem CID | 2318874 |
| Molecular Formula | C22H18N4O3S2 |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | 2-(furan-2-ylmethylidene)-N,N'-bis(phenylcarbamothioyl)propanediamide |
| SMILES | O=C(NC(=S)Nc1ccccc1)C(=Cc1ccco1)C(=O)NC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C22H18N4O3S2/c27-19(25-21(30)23-15-8-3-1-4-9-15)18(14-17-12-7-13-29-17)20(28)26-22(31)24-16-10-5-2-6-11-16/h1-14H,(H2,23,25,27,30)(H2,24,26,28,31) |
| InChIKey | TTZCLBCQUNJKOG-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 95.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|