C22H25N3O2 — CID 23204503
ethyl 1-[4-(dimethylamino)cyclohex-2-en-1-yl]-9H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 23204503) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is ethyl 1-[4-(dimethylamino)cyclohex-2-en-1-yl]-9H-pyrido[3,4-b]indole-3-carboxylate.
| Compound Name | ethyl 1-[4-(dimethylamino)cyclohex-2-en-1-yl]-9H-pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 23204503 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | ethyl 1-[4-(dimethylamino)cyclohex-2-en-1-yl]-9H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | CCOC(=O)c1cc2c([nH]c3ccccc32)c(C2C=CC(N(C)C)CC2)n1 |
| InChI | InChI=1S/C22H25N3O2/c1-4-27-22(26)19-13-17-16-7-5-6-8-18(16)23-21(17)20(24-19)14-9-11-15(12-10-14)25(2)3/h5-9,11,13-15,23H,4,10,12H2,1-3H3 |
| InChIKey | UEHUAKPPNNVFTF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|