C17H18Br2N2O4 — CID 23204698
N-(3,5-dibromo-4-pyridinyl)-3-(2-ethoxyethoxy)-4-methoxybenzamide (PubChem CID 23204698) has the molecular formula C17H18Br2N2O4 and a molecular weight of 474.15 g/mol. Its IUPAC name is N-(3,5-dibromo-4-pyridinyl)-3-(2-ethoxyethoxy)-4-methoxybenzamide.
| Compound Name | N-(3,5-dibromo-4-pyridinyl)-3-(2-ethoxyethoxy)-4-methoxybenzamide |
|---|---|
| PubChem CID | 23204698 |
| Molecular Formula | C17H18Br2N2O4 |
| Molecular Weight | 474.15 g/mol |
| Exact Mass | 471.96 |
| IUPAC Name | N-(3,5-dibromo-4-pyridinyl)-3-(2-ethoxyethoxy)-4-methoxybenzamide |
| SMILES | CCOCCOc1cc(C(=O)Nc2c(Br)cncc2Br)ccc1OC |
| InChI | InChI=1S/C17H18Br2N2O4/c1-3-24-6-7-25-15-8-11(4-5-14(15)23-2)17(22)21-16-12(18)9-20-10-13(16)19/h4-5,8-10H,3,6-7H2,1-2H3,(H,20,21,22) |
| InChIKey | DXDGARFKMSITGH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.15 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|