C22H16O5 — CID 23208590
10-acetyl-1,8-dihydroxy-2-(4-hydroxyphenyl)-10H-anthracen-9-one (PubChem CID 23208590) has the molecular formula C22H16O5 and a molecular weight of 360.37 g/mol. Its IUPAC name is 10-acetyl-1,8-dihydroxy-2-(4-hydroxyphenyl)-10H-anthracen-9-one.
| Compound Name | 10-acetyl-1,8-dihydroxy-2-(4-hydroxyphenyl)-10H-anthracen-9-one |
|---|---|
| PubChem CID | 23208590 |
| Molecular Formula | C22H16O5 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 10-acetyl-1,8-dihydroxy-2-(4-hydroxyphenyl)-10H-anthracen-9-one |
| SMILES | CC(=O)C1c2cccc(O)c2C(=O)c2c1ccc(-c1ccc(O)cc1)c2O |
| InChI | InChI=1S/C22H16O5/c1-11(23)18-15-3-2-4-17(25)19(15)22(27)20-16(18)10-9-14(21(20)26)12-5-7-13(24)8-6-12/h2-10,18,24-26H,1H3 |
| InChIKey | HFBAGCXEINTKEN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |