C17H30N4O2 — CID 23220130
benzene-1,4-dicarboxamide;5,6-dimethylheptane-1,6-diamine (PubChem CID 23220130) has the molecular formula C17H30N4O2 and a molecular weight of 322.45 g/mol. Its IUPAC name is benzene-1,4-dicarboxamide;5,6-dimethylheptane-1,6-diamine.
| Compound Name | benzene-1,4-dicarboxamide;5,6-dimethylheptane-1,6-diamine |
|---|---|
| PubChem CID | 23220130 |
| Molecular Formula | C17H30N4O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | benzene-1,4-dicarboxamide;5,6-dimethylheptane-1,6-diamine |
| SMILES | CC(CCCCN)C(C)(C)N.NC(=O)c1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C9H22N2.C8H8N2O2/c1-8(9(2,3)11)6-4-5-7-10;9-7(11)5-1-2-6(4-3-5)8(10)12/h8H,4-7,10-11H2,1-3H3;1-4H,(H2,9,11)(H2,10,12) |
| InChIKey | PFQGXXHUHOCMLG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 138.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|