C20H26N4O2 — CID 174496397
4-(7-azabicyclo[2.2.1]hepta-1,3,5-triene-7-carbonyl)benzamide;hexane-1,6-diamine (PubChem CID 174496397) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 4-(7-azabicyclo[2.2.1]hepta-1,3,5-triene-7-carbonyl)benzamide;hexane-1,6-diamine.
| Compound Name | 4-(7-azabicyclo[2.2.1]hepta-1,3,5-triene-7-carbonyl)benzamide;hexane-1,6-diamine |
|---|---|
| PubChem CID | 174496397 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 4-(7-azabicyclo[2.2.1]hepta-1,3,5-triene-7-carbonyl)benzamide;hexane-1,6-diamine |
| SMILES | NC(=O)c1ccc(C(=O)n2c3ccc2cc3)cc1.NCCCCCCN |
| InChI | InChI=1S/C14H10N2O2.C6H16N2/c15-13(17)9-1-3-10(4-2-9)14(18)16-11-5-6-12(16)8-7-11;7-5-3-1-2-4-6-8/h1-8H,(H2,15,17);1-8H2 |
| InChIKey | CRZNIQWTNLWXRC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 117.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|