C15H11N2NaO4 — CID 174816659
sodium;4-(7-azabicyclo[2.2.1]hepta-1,3,5-triene-7-carbonyl)benzamide;formate (PubChem CID 174816659) has the molecular formula C15H11N2NaO4 and a molecular weight of 306.25 g/mol. Its IUPAC name is sodium;4-(7-azabicyclo[2.2.1]hepta-1,3,5-triene-7-carbonyl)benzamide;formate.
| Compound Name | sodium;4-(7-azabicyclo[2.2.1]hepta-1,3,5-triene-7-carbonyl)benzamide;formate |
|---|---|
| PubChem CID | 174816659 |
| Molecular Formula | C15H11N2NaO4 |
| Molecular Weight | 306.25 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | sodium;4-(7-azabicyclo[2.2.1]hepta-1,3,5-triene-7-carbonyl)benzamide;formate |
| SMILES | NC(=O)c1ccc(C(=O)n2c3ccc2cc3)cc1.O=C[O-].[Na+] |
| InChI | InChI=1S/C14H10N2O2.CH2O2.Na/c15-13(17)9-1-3-10(4-2-9)14(18)16-11-5-6-12(16)8-7-11;2-1-3;/h1-8H,(H2,15,17);1H,(H,2,3);/q;;+1/p-1 |
| InChIKey | GLLGFJCMAGMGNF-UHFFFAOYSA-M |
| XLogP | -2.76 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.25 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|