C26H46O2Si — CID 23230868
tert-butyl-[[(1R,4Z,7S,8E,11S)-7,11-dimethyl-7-(4-methylpent-3-enyl)-12-oxabicyclo[9.1.0]dodeca-4,8-dien-4-yl]methoxy]-dimethylsilane (PubChem CID 23230868) has the molecular formula C26H46O2Si and a molecular weight of 418.74 g/mol. Its IUPAC name is tert-butyl-[[(1R,4Z,7S,8E,11S)-7,11-dimethyl-7-(4-methylpent-3-enyl)-12-oxabicyclo[9.1.0]dodeca-4,8-dien-4-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1R,4Z,7S,8E,11S)-7,11-dimethyl-7-(4-methylpent-3-enyl)-12-oxabicyclo[9.1.0]dodeca-4,8-dien-4-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 23230868 |
| Molecular Formula | C26H46O2Si |
| Molecular Weight | 418.74 g/mol |
| Exact Mass | 418.33 |
| IUPAC Name | tert-butyl-[[(1R,4Z,7S,8E,11S)-7,11-dimethyl-7-(4-methylpent-3-enyl)-12-oxabicyclo[9.1.0]dodeca-4,8-dien-4-yl]methoxy]-dimethylsilane |
| SMILES | CC(C)=CCC[C@]1(C)/C=C/C[C@]2(C)O[C@@H]2CC/C(CO[Si](C)(C)C(C)(C)C)=C/C1 |
| InChI | InChI=1S/C26H46O2Si/c1-21(2)12-10-16-25(6)17-11-18-26(7)23(28-26)14-13-22(15-19-25)20-27-29(8,9)24(3,4)5/h11-12,15,17,23H,10,13-14,16,18-20H2,1-9H3/b17-11+,22-15-/t23-,25-,26+/m1/s1 |
| InChIKey | FSXFICITZVPPQO-DAIHCDAMSA-N |
| XLogP | 7.97 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.74 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|