C29H52O4Si — CID 78096232
[5-[3-[[2,6-dimethoxy-1-(3-methylbut-2-enyl)cyclohexa-2,5-dien-1-yl]methyl]-2-methyloxiran-2-yl]-2-methylpentan-2-yl]oxy-triethylsilane (PubChem CID 78096232) has the molecular formula C29H52O4Si and a molecular weight of 492.82 g/mol. Its IUPAC name is [5-[3-[[2,6-dimethoxy-1-(3-methylbut-2-enyl)cyclohexa-2,5-dien-1-yl]methyl]-2-methyloxiran-2-yl]-2-methylpentan-2-yl]oxy-triethylsilane.
| Compound Name | [5-[3-[[2,6-dimethoxy-1-(3-methylbut-2-enyl)cyclohexa-2,5-dien-1-yl]methyl]-2-methyloxiran-2-yl]-2-methylpentan-2-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 78096232 |
| Molecular Formula | C29H52O4Si |
| Molecular Weight | 492.82 g/mol |
| Exact Mass | 492.36 |
| IUPAC Name | [5-[3-[[2,6-dimethoxy-1-(3-methylbut-2-enyl)cyclohexa-2,5-dien-1-yl]methyl]-2-methyloxiran-2-yl]-2-methylpentan-2-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)OC(C)(C)CCCC1(C)OC1CC1(CC=C(C)C)C(OC)=CCC=C1OC |
| InChI | InChI=1S/C29H52O4Si/c1-11-34(12-2,13-3)33-27(6,7)19-15-20-28(8)26(32-28)22-29(21-18-23(4)5)24(30-9)16-14-17-25(29)31-10/h16-18,26H,11-15,19-22H2,1-10H3 |
| InChIKey | HYHLODQTHQBZEV-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.82 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|