C8H11BrClF — CID 23234344
(1S,5S,7R)-5-bromo-7-chloro-5-deuterio-7-fluoro-1-methylbicyclo[4.1.0]heptane (PubChem CID 23234344) has the molecular formula C8H11BrClF and a molecular weight of 242.54 g/mol. Its IUPAC name is (1S,5S,7R)-5-bromo-7-chloro-5-deuterio-7-fluoro-1-methylbicyclo[4.1.0]heptane.
| Compound Name | (1S,5S,7R)-5-bromo-7-chloro-5-deuterio-7-fluoro-1-methylbicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 23234344 |
| Molecular Formula | C8H11BrClF |
| Molecular Weight | 242.54 g/mol |
| Exact Mass | 240.98 |
| IUPAC Name | (1S,5S,7R)-5-bromo-7-chloro-5-deuterio-7-fluoro-1-methylbicyclo[4.1.0]heptane |
| SMILES | [2H]C1(Br)CCC[C@@]2(C)C1[C@@]2(F)Cl |
| InChI | InChI=1S/C8H11BrClF/c1-7-4-2-3-5(9)6(7)8(7,10)11/h5-6H,2-4H2,1H3/t5?,6?,7-,8-/m0/s1/i5D |
| InChIKey | YCXZQTJZJQJPQC-ZBCPISKSSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.54 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|