C25H30F3NO3 — CID 23244597
[(2R)-4-(1,5,5-trimethyl-6,7-dihydrocyclopenta[c]pyridin-6-yl)butan-2-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 23244597) has the molecular formula C25H30F3NO3 and a molecular weight of 449.51 g/mol. Its IUPAC name is [(2R)-4-(1,5,5-trimethyl-6,7-dihydrocyclopenta[c]pyridin-6-yl)butan-2-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(2R)-4-(1,5,5-trimethyl-6,7-dihydrocyclopenta[c]pyridin-6-yl)butan-2-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 23244597 |
| Molecular Formula | C25H30F3NO3 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | [(2R)-4-(1,5,5-trimethyl-6,7-dihydrocyclopenta[c]pyridin-6-yl)butan-2-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CO[C@](C(=O)O[C@H](C)CCC1Cc2c(ccnc2C)C1(C)C)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C25H30F3NO3/c1-16(11-12-19-15-20-17(2)29-14-13-21(20)23(19,3)4)32-22(30)24(31-5,25(26,27)28)18-9-7-6-8-10-18/h6-10,13-14,16,19H,11-12,15H2,1-5H3/t16-,19?,24+/m1/s1 |
| InChIKey | VLJWTJNAXNGUQD-DUFMKPFPSA-N |
| XLogP | 5.66 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |