C13H9Cl3N2O6S — CID 23246752
[(Z)-[(5R,6R)-3,5,6-trichloro-5-methyl-4-oxocyclohex-2-en-1-ylidene]amino] 4-nitrobenzenesulfonate (PubChem CID 23246752) has the molecular formula C13H9Cl3N2O6S and a molecular weight of 427.65 g/mol. Its IUPAC name is [(Z)-[(5R,6R)-3,5,6-trichloro-5-methyl-4-oxocyclohex-2-en-1-ylidene]amino] 4-nitrobenzenesulfonate.
| Compound Name | [(Z)-[(5R,6R)-3,5,6-trichloro-5-methyl-4-oxocyclohex-2-en-1-ylidene]amino] 4-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 23246752 |
| Molecular Formula | C13H9Cl3N2O6S |
| Molecular Weight | 427.65 g/mol |
| Exact Mass | 425.92 |
| IUPAC Name | [(Z)-[(5R,6R)-3,5,6-trichloro-5-methyl-4-oxocyclohex-2-en-1-ylidene]amino] 4-nitrobenzenesulfonate |
| SMILES | C[C@@]1(Cl)C(=O)C(Cl)=C/C(=N/OS(=O)(=O)c2ccc([N+](=O)[O-])cc2)[C@H]1Cl |
| InChI | InChI=1S/C13H9Cl3N2O6S/c1-13(16)11(15)10(6-9(14)12(13)19)17-24-25(22,23)8-4-2-7(3-5-8)18(20)21/h2-6,11H,1H3/b17-10-/t11-,13+/m1/s1 |
| InChIKey | RCWHKYOHTRZSDB-JYINORFOSA-N |
| XLogP | 2.97 |
| TPSA | 115.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.65 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|