C58H71NO7Si3 — CID 23250169
[(2S,3R,4R,5S,6R)-3-acetamido-2,5-bis[[tert-butyl(diphenyl)silyl]oxy]-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-4-yl] acetate (PubChem CID 23250169) has the molecular formula C58H71NO7Si3 and a molecular weight of 978.46 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6R)-3-acetamido-2,5-bis[[tert-butyl(diphenyl)silyl]oxy]-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-4-yl] acetate.
| Compound Name | [(2S,3R,4R,5S,6R)-3-acetamido-2,5-bis[[tert-butyl(diphenyl)silyl]oxy]-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-4-yl] acetate |
|---|---|
| PubChem CID | 23250169 |
| Molecular Formula | C58H71NO7Si3 |
| Molecular Weight | 978.46 g/mol |
| Exact Mass | 977.45 |
| IUPAC Name | [(2S,3R,4R,5S,6R)-3-acetamido-2,5-bis[[tert-butyl(diphenyl)silyl]oxy]-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-4-yl] acetate |
| SMILES | CC(=O)N[C@H]1[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C58H71NO7Si3/c1-43(60)59-52-54(63-44(2)61)53(65-68(57(6,7)8,47-34-22-14-23-35-47)48-36-24-15-25-37-48)51(42-62-67(56(3,4)5,45-30-18-12-19-31-45)46-32-20-13-21-33-46)64-55(52)66-69(58(9,10)11,49-38-26-16-27-39-49)50-40-28-17-29-41-50/h12-41,51-55H,42H2,1-11H3,(H,59,60)/t51-,52-,53-,54-,55+/m1/s1 |
| InChIKey | WASCJHYRRWVLPI-GAJGGRIYSA-N |
| XLogP | 8.25 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 978.46 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|