C25H23N3O3 — CID 23252797
4-nitro-N-(1-phenyl-2-propan-2-yl-1,4-dihydroisoquinolin-3-ylidene)benzamide (PubChem CID 23252797) has the molecular formula C25H23N3O3 and a molecular weight of 413.48 g/mol. Its IUPAC name is 4-nitro-N-(1-phenyl-2-propan-2-yl-1,4-dihydroisoquinolin-3-ylidene)benzamide.
| Compound Name | 4-nitro-N-(1-phenyl-2-propan-2-yl-1,4-dihydroisoquinolin-3-ylidene)benzamide |
|---|---|
| PubChem CID | 23252797 |
| Molecular Formula | C25H23N3O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 4-nitro-N-(1-phenyl-2-propan-2-yl-1,4-dihydroisoquinolin-3-ylidene)benzamide |
| SMILES | CC(C)N1/C(=N/C(=O)c2ccc([N+](=O)[O-])cc2)Cc2ccccc2C1c1ccccc1 |
| InChI | InChI=1S/C25H23N3O3/c1-17(2)27-23(26-25(29)19-12-14-21(15-13-19)28(30)31)16-20-10-6-7-11-22(20)24(27)18-8-4-3-5-9-18/h3-15,17,24H,16H2,1-2H3/b26-23+ |
| InChIKey | WYQLBTGINXAGPO-WNAAXNPUSA-N |
| XLogP | 5.19 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|