C21H20N4 — CID 23253050
(1S,4R,11R)-1,4,5,8,9,11-hexamethyltricyclo[5.3.1.04,11]undeca-5,7,9-triene-2,2,3,3-tetracarbonitrile (PubChem CID 23253050) has the molecular formula C21H20N4 and a molecular weight of 328.42 g/mol. Its IUPAC name is (1S,4R,11R)-1,4,5,8,9,11-hexamethyltricyclo[5.3.1.04,11]undeca-5,7,9-triene-2,2,3,3-tetracarbonitrile.
| Compound Name | (1S,4R,11R)-1,4,5,8,9,11-hexamethyltricyclo[5.3.1.04,11]undeca-5,7,9-triene-2,2,3,3-tetracarbonitrile |
|---|---|
| PubChem CID | 23253050 |
| Molecular Formula | C21H20N4 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (1S,4R,11R)-1,4,5,8,9,11-hexamethyltricyclo[5.3.1.04,11]undeca-5,7,9-triene-2,2,3,3-tetracarbonitrile |
| SMILES | CC1=C[C@]2(C)C(C#N)(C#N)C(C#N)(C#N)[C@]3(C)C(C)=CC(=C1C)[C@@]32C |
| InChI | InChI=1S/C21H20N4/c1-13-8-17(4)19(6)16(15(13)3)7-14(2)18(19,5)21(11-24,12-25)20(17,9-22)10-23/h7-8H,1-6H3/t17-,18+,19+/m0/s1 |
| InChIKey | CZYHXZBXJQBHPP-IPMKNSEASA-N |
| XLogP | 4.32 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'} |
|---|