C19H24Cl2O4 — CID 23254125
[(2S,3R,4aS,8aR)-2-[(2,4-dichlorophenyl)methoxymethyl]-2-methyl-3,4,4a,5,6,7,8,8a-octahydrochromen-3-yl] formate (PubChem CID 23254125) has the molecular formula C19H24Cl2O4 and a molecular weight of 387.30 g/mol. Its IUPAC name is [(2S,3R,4aS,8aR)-2-[(2,4-dichlorophenyl)methoxymethyl]-2-methyl-3,4,4a,5,6,7,8,8a-octahydrochromen-3-yl] formate.
| Compound Name | [(2S,3R,4aS,8aR)-2-[(2,4-dichlorophenyl)methoxymethyl]-2-methyl-3,4,4a,5,6,7,8,8a-octahydrochromen-3-yl] formate |
|---|---|
| PubChem CID | 23254125 |
| Molecular Formula | C19H24Cl2O4 |
| Molecular Weight | 387.30 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | [(2S,3R,4aS,8aR)-2-[(2,4-dichlorophenyl)methoxymethyl]-2-methyl-3,4,4a,5,6,7,8,8a-octahydrochromen-3-yl] formate |
| SMILES | C[C@@]1(COCc2ccc(Cl)cc2Cl)O[C@@H]2CCCC[C@H]2C[C@H]1OC=O |
| InChI | InChI=1S/C19H24Cl2O4/c1-19(11-23-10-14-6-7-15(20)9-16(14)21)18(24-12-22)8-13-4-2-3-5-17(13)25-19/h6-7,9,12-13,17-18H,2-5,8,10-11H2,1H3/t13-,17+,18+,19-/m0/s1 |
| InChIKey | SJJBTQARSSQBIU-CJODITQLSA-N |
| XLogP | 4.79 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.30 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|